C13H26OS — CID 67811965
2,4-dipentyl-1,3-oxathiolane (PubChem CID 67811965) has the molecular formula C13H26OS and a molecular weight of 230.42 g/mol. Its IUPAC name is 2,4-dipentyl-1,3-oxathiolane.
| Compound Name | 2,4-dipentyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 67811965 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2,4-dipentyl-1,3-oxathiolane |
| SMILES | CCCCCC1COC(CCCCC)S1 |
| InChI | InChI=1S/C13H26OS/c1-3-5-7-9-12-11-14-13(15-12)10-8-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | OSHHFMWPFDYZOH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|