C12H24OS — CID 76968751
(2S,4S)-2-pentyl-4-propyl-1,3-oxathiane (PubChem CID 76968751) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is (2S,4S)-2-pentyl-4-propyl-1,3-oxathiane.
| Compound Name | (2S,4S)-2-pentyl-4-propyl-1,3-oxathiane |
|---|---|
| PubChem CID | 76968751 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S,4S)-2-pentyl-4-propyl-1,3-oxathiane |
| SMILES | CCCCC[C@H]1OCC[C@H](CCC)S1 |
| InChI | InChI=1S/C12H24OS/c1-3-5-6-8-12-13-10-9-11(14-12)7-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | PBRQZDFWTQLQRQ-RYUDHWBXSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|