C12H22OS — CID 102333847
(3aS,7aR)-4-pentyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan (PubChem CID 102333847) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is (3aS,7aR)-4-pentyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan.
| Compound Name | (3aS,7aR)-4-pentyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan |
|---|---|
| PubChem CID | 102333847 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (3aS,7aR)-4-pentyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan |
| SMILES | CCCCCC1SCC[C@H]2OCC[C@H]12 |
| InChI | InChI=1S/C12H22OS/c1-2-3-4-5-12-10-6-8-13-11(10)7-9-14-12/h10-12H,2-9H2,1H3/t10-,11+,12?/m0/s1 |
| InChIKey | IWJPZKMFBSUUAB-WIKAKEFZSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|