C22H18N2O5S — CID 19349879
[2-[(4-methyl-5-oxo-2-phenyl-1,3-oxazol-4-yl)methyl]-3-pyridinyl] benzenesulfonate (PubChem CID 19349879) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is [2-[(4-methyl-5-oxo-2-phenyl-1,3-oxazol-4-yl)methyl]-3-pyridinyl] benzenesulfonate.
| Compound Name | [2-[(4-methyl-5-oxo-2-phenyl-1,3-oxazol-4-yl)methyl]-3-pyridinyl] benzenesulfonate |
|---|---|
| PubChem CID | 19349879 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [2-[(4-methyl-5-oxo-2-phenyl-1,3-oxazol-4-yl)methyl]-3-pyridinyl] benzenesulfonate |
| SMILES | CC1(Cc2ncccc2OS(=O)(=O)c2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C22H18N2O5S/c1-22(21(25)28-20(24-22)16-9-4-2-5-10-16)15-18-19(13-8-14-23-18)29-30(26,27)17-11-6-3-7-12-17/h2-14H,15H2,1H3 |
| InChIKey | UWAXQYJHMNNZGE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|