C16H18N2O5S — CID 23497584
ethyl 2-amino-3-[3-(benzenesulfonyloxy)-2-pyridinyl]propanoate (PubChem CID 23497584) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-(benzenesulfonyloxy)-2-pyridinyl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-(benzenesulfonyloxy)-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 23497584 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl 2-amino-3-[3-(benzenesulfonyloxy)-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ncccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-2-22-16(19)13(17)11-14-15(9-6-10-18-14)23-24(20,21)12-7-4-3-5-8-12/h3-10,13H,2,11,17H2,1H3 |
| InChIKey | BZTILMJELJOPQX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|