C27H40N2O2 — CID 19352520
(E)-7-[4-(5-decoxypyrimidin-2-yl)phenyl]hept-6-en-2-ol (PubChem CID 19352520) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is (E)-7-[4-(5-decoxypyrimidin-2-yl)phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[4-(5-decoxypyrimidin-2-yl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 19352520 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | (E)-7-[4-(5-decoxypyrimidin-2-yl)phenyl]hept-6-en-2-ol |
| SMILES | CCCCCCCCCCOc1cnc(-c2ccc(/C=C/CCCC(C)O)cc2)nc1 |
| InChI | InChI=1S/C27H40N2O2/c1-3-4-5-6-7-8-9-13-20-31-26-21-28-27(29-22-26)25-18-16-24(17-19-25)15-12-10-11-14-23(2)30/h12,15-19,21-23,30H,3-11,13-14,20H2,1-2H3/b15-12+ |
| InChIKey | CKVLFOMHMOCEBG-NTCAYCPXSA-N |
| XLogP | 7.23 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|