C22H20N2O — CID 19354019
2-(3,4-dimethylphenyl)-6-methoxy-1-phenylbenzimidazole (PubChem CID 19354019) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-6-methoxy-1-phenylbenzimidazole.
| Compound Name | 2-(3,4-dimethylphenyl)-6-methoxy-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 19354019 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-6-methoxy-1-phenylbenzimidazole |
| SMILES | COc1ccc2nc(-c3ccc(C)c(C)c3)n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C22H20N2O/c1-15-9-10-17(13-16(15)2)22-23-20-12-11-19(25-3)14-21(20)24(22)18-7-5-4-6-8-18/h4-14H,1-3H3 |
| InChIKey | AMEZPTYLCHBGMW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |