C24H22N2O3 — CID 67365280
2-(2,3-diphenylbenzimidazol-5-yl)oxy-3-methylbutanoic acid (PubChem CID 67365280) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(2,3-diphenylbenzimidazol-5-yl)oxy-3-methylbutanoic acid.
| Compound Name | 2-(2,3-diphenylbenzimidazol-5-yl)oxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67365280 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(2,3-diphenylbenzimidazol-5-yl)oxy-3-methylbutanoic acid |
| SMILES | CC(C)C(Oc1ccc2nc(-c3ccccc3)n(-c3ccccc3)c2c1)C(=O)O |
| InChI | InChI=1S/C24H22N2O3/c1-16(2)22(24(27)28)29-19-13-14-20-21(15-19)26(18-11-7-4-8-12-18)23(25-20)17-9-5-3-6-10-17/h3-16,22H,1-2H3,(H,27,28) |
| InChIKey | SCPSSUWOEPPTRL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |