C23H22N2O3S — CID 142668346
2-(3-phenyl-2-thiophen-3-ylbenzimidazol-5-yl)oxyhexanoic acid (PubChem CID 142668346) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-(3-phenyl-2-thiophen-3-ylbenzimidazol-5-yl)oxyhexanoic acid.
| Compound Name | 2-(3-phenyl-2-thiophen-3-ylbenzimidazol-5-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 142668346 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-(3-phenyl-2-thiophen-3-ylbenzimidazol-5-yl)oxyhexanoic acid |
| SMILES | CCCCC(Oc1ccc2nc(-c3ccsc3)n(-c3ccccc3)c2c1)C(=O)O |
| InChI | InChI=1S/C23H22N2O3S/c1-2-3-9-21(23(26)27)28-18-10-11-19-20(14-18)25(17-7-5-4-6-8-17)22(24-19)16-12-13-29-15-16/h4-8,10-15,21H,2-3,9H2,1H3,(H,26,27) |
| InChIKey | SSBGZBBMUKSWJX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |