C11H21NO5 — CID 19354110
N-[1,1-bis(ethylperoxy)butan-2-yl]prop-2-enamide (PubChem CID 19354110) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[1,1-bis(ethylperoxy)butan-2-yl]prop-2-enamide.
| Compound Name | N-[1,1-bis(ethylperoxy)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19354110 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[1,1-bis(ethylperoxy)butan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(CC)C(OOCC)OOCC |
| InChI | InChI=1S/C11H21NO5/c1-5-9(12-10(13)6-2)11(16-14-7-3)17-15-8-4/h6,9,11H,2,5,7-8H2,1,3-4H3,(H,12,13) |
| InChIKey | NOPKOHHORKFNJX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|