C10H19NO3 — CID 19376143
(E)-N-(1,1-dimethoxybutan-2-yl)but-2-enamide (PubChem CID 19376143) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-N-(1,1-dimethoxybutan-2-yl)but-2-enamide.
| Compound Name | (E)-N-(1,1-dimethoxybutan-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 19376143 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E)-N-(1,1-dimethoxybutan-2-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)NC(CC)C(OC)OC |
| InChI | InChI=1S/C10H19NO3/c1-5-7-9(12)11-8(6-2)10(13-3)14-4/h5,7-8,10H,6H2,1-4H3,(H,11,12)/b7-5+ |
| InChIKey | COPJHKLIXUSSGN-FNORWQNLSA-N |
| XLogP | 1.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|