C13H25NO3 — CID 19376129
N-[1,1-di(propan-2-yloxy)butan-2-yl]prop-2-enamide (PubChem CID 19376129) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[1,1-di(propan-2-yloxy)butan-2-yl]prop-2-enamide.
| Compound Name | N-[1,1-di(propan-2-yloxy)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19376129 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[1,1-di(propan-2-yloxy)butan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(CC)C(OC(C)C)OC(C)C |
| InChI | InChI=1S/C13H25NO3/c1-7-11(14-12(15)8-2)13(16-9(3)4)17-10(5)6/h8-11,13H,2,7H2,1,3-6H3,(H,14,15) |
| InChIKey | ATLRXOXFBHSHLV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|