C14H27NO3 — CID 19376113
N-(1,1-diethoxyheptan-2-yl)prop-2-enamide (PubChem CID 19376113) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is N-(1,1-diethoxyheptan-2-yl)prop-2-enamide.
| Compound Name | N-(1,1-diethoxyheptan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19376113 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N-(1,1-diethoxyheptan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(CCCCC)C(OCC)OCC |
| InChI | InChI=1S/C14H27NO3/c1-5-9-10-11-12(15-13(16)6-2)14(17-7-3)18-8-4/h6,12,14H,2,5,7-11H2,1,3-4H3,(H,15,16) |
| InChIKey | SKJOJYOEHDPNAF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|