C11H21NO3 — CID 19376139
N-(1,1-dimethoxyhexan-2-yl)prop-2-enamide (PubChem CID 19376139) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-(1,1-dimethoxyhexan-2-yl)prop-2-enamide.
| Compound Name | N-(1,1-dimethoxyhexan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19376139 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-(1,1-dimethoxyhexan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(CCCC)C(OC)OC |
| InChI | InChI=1S/C11H21NO3/c1-5-7-8-9(11(14-3)15-4)12-10(13)6-2/h6,9,11H,2,5,7-8H2,1,3-4H3,(H,12,13) |
| InChIKey | WJHLEHZOEOQRIM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|