C22H22NO4P — CID 19357680
3-[hydroxy(1-pyridin-3-ylethyl)phosphoryl]-2,3-diphenylpropanoic acid (PubChem CID 19357680) has the molecular formula C22H22NO4P and a molecular weight of 395.40 g/mol. Its IUPAC name is 3-[hydroxy(1-pyridin-3-ylethyl)phosphoryl]-2,3-diphenylpropanoic acid.
| Compound Name | 3-[hydroxy(1-pyridin-3-ylethyl)phosphoryl]-2,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 19357680 |
| Molecular Formula | C22H22NO4P |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[hydroxy(1-pyridin-3-ylethyl)phosphoryl]-2,3-diphenylpropanoic acid |
| SMILES | CC(c1cccnc1)P(=O)(O)C(c1ccccc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H22NO4P/c1-16(19-13-8-14-23-15-19)28(26,27)21(18-11-6-3-7-12-18)20(22(24)25)17-9-4-2-5-10-17/h2-16,20-21H,1H3,(H,24,25)(H,26,27) |
| InChIKey | SNOGXNJQLXNFMB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|