C18H22NO4P — CID 19357792
3-[hydroxy(pyridin-3-yl)phosphoryl]-4,4-dimethyl-2-phenylpentanoic acid (PubChem CID 19357792) has the molecular formula C18H22NO4P and a molecular weight of 347.35 g/mol. Its IUPAC name is 3-[hydroxy(pyridin-3-yl)phosphoryl]-4,4-dimethyl-2-phenylpentanoic acid.
| Compound Name | 3-[hydroxy(pyridin-3-yl)phosphoryl]-4,4-dimethyl-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 19357792 |
| Molecular Formula | C18H22NO4P |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-[hydroxy(pyridin-3-yl)phosphoryl]-4,4-dimethyl-2-phenylpentanoic acid |
| SMILES | CC(C)(C)C(C(C(=O)O)c1ccccc1)P(=O)(O)c1cccnc1 |
| InChI | InChI=1S/C18H22NO4P/c1-18(2,3)16(24(22,23)14-10-7-11-19-12-14)15(17(20)21)13-8-5-4-6-9-13/h4-12,15-16H,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | CUMUDPHIYWXSAL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|