C19H17N3S — CID 19358185
N'-naphthalen-1-yl-2,3-dihydro-1,4-benzothiazine-4-carboximidamide (PubChem CID 19358185) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N'-naphthalen-1-yl-2,3-dihydro-1,4-benzothiazine-4-carboximidamide.
| Compound Name | N'-naphthalen-1-yl-2,3-dihydro-1,4-benzothiazine-4-carboximidamide |
|---|---|
| PubChem CID | 19358185 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N'-naphthalen-1-yl-2,3-dihydro-1,4-benzothiazine-4-carboximidamide |
| SMILES | N/C(=N\c1cccc2ccccc12)N1CCSc2ccccc21 |
| InChI | InChI=1S/C19H17N3S/c20-19(22-12-13-23-18-11-4-3-10-17(18)22)21-16-9-5-7-14-6-1-2-8-15(14)16/h1-11H,12-13H2,(H2,20,21) |
| InChIKey | DITXRBFTTUIEJI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|