About ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+)
ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) (PubChem CID 19359925) has the molecular formula C10H25NO3Sn
and a molecular weight of 326.03 g/mol. Its IUPAC name is ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+).
Molecular Properties
| Compound Name | ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) |
| PubChem CID | 19359925 |
| Molecular Formula | C10H25NO3Sn |
| Molecular Weight | 326.03 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) |
| SMILES | CCNCOC[Sn+2]CC.CC[O-].CC[O-] |
| InChI | InChI=1S/C4H10NO.2C2H5O.C2H5.Sn/c1-3-5-4-6-2;2*1-2-3;1-2;/h5H,2-4H2,1H3;2*2H2,1H3;1H2,2H3;/q;2*-1;;+2 |
| InChIKey | ICEPJHAYXBHAAN-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.03 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+)?
The IUPAC name of ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) (CID 19359925) is ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+).
What is the SMILES notation for ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+)?
The canonical SMILES for ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) is CCNCOC[Sn+2]CC.CC[O-].CC[O-].
What is the InChIKey of ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+)?
The InChIKey is ICEPJHAYXBHAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO.2C2H5O.C2H5.Sn/c1-3-5-4-6-2;2*1-2-3;1-2;/h5H,2-4H2,1H3;2*2H2,1H3;1H2,2H3;/q;2*-1;;+2.
What are the key properties of ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+)?
ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) has a molecular weight of 326.03 g/mol, XLogP of -0.60, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;ethyl(ethylaminomethoxymethyl)tin(2+) is sourced from PubChem (CID 19359925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).