C10H23N3 — CID 19361178
1,1,2-tripropylguanidine (PubChem CID 19361178) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1,1,2-tripropylguanidine.
| Compound Name | 1,1,2-tripropylguanidine |
|---|---|
| PubChem CID | 19361178 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1,1,2-tripropylguanidine |
| SMILES | CCC/N=C(\N)N(CCC)CCC |
| InChI | InChI=1S/C10H23N3/c1-4-7-12-10(11)13(8-5-2)9-6-3/h4-9H2,1-3H3,(H2,11,12) |
| InChIKey | AXAUYAGMJCYOMM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|