C21H25NO3 — CID 19363531
(E)-3-[3-[4-methoxy-3-(pentylamino)phenyl]phenyl]prop-2-enoic acid (PubChem CID 19363531) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (E)-3-[3-[4-methoxy-3-(pentylamino)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[4-methoxy-3-(pentylamino)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 19363531 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (E)-3-[3-[4-methoxy-3-(pentylamino)phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCNc1cc(-c2cccc(/C=C/C(=O)O)c2)ccc1OC |
| InChI | InChI=1S/C21H25NO3/c1-3-4-5-13-22-19-15-18(10-11-20(19)25-2)17-8-6-7-16(14-17)9-12-21(23)24/h6-12,14-15,22H,3-5,13H2,1-2H3,(H,23,24)/b12-9+ |
| InChIKey | QLJMRIZSVNARPY-FMIVXFBMSA-N |
| XLogP | 5.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|