C21H26N2O3 — CID 19367952
N-tert-butyl-N'-(3-methoxybenzoyl)-3,5-dimethylbenzohydrazide (PubChem CID 19367952) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-tert-butyl-N'-(3-methoxybenzoyl)-3,5-dimethylbenzohydrazide.
| Compound Name | N-tert-butyl-N'-(3-methoxybenzoyl)-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 19367952 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-tert-butyl-N'-(3-methoxybenzoyl)-3,5-dimethylbenzohydrazide |
| SMILES | COc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-14-10-15(2)12-17(11-14)20(25)23(21(3,4)5)22-19(24)16-8-7-9-18(13-16)26-6/h7-13H,1-6H3,(H,22,24) |
| InChIKey | WMVHARKWMABWRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|