About N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide
N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide (PubChem CID 19368177) has the molecular formula C17H21N3O
and a molecular weight of 283.38 g/mol. Its IUPAC name is N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide |
| PubChem CID | 19368177 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide |
| SMILES | CN(N(C(=O)c1ccccc1)c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C17H21N3O/c1-17(2,3)19(4)20(15-12-8-9-13-18-15)16(21)14-10-6-5-7-11-14/h5-13H,1-4H3 |
| InChIKey | CRNQIDHNTIHKBF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide?
The IUPAC name of N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide (CID 19368177) is N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide.
What is the SMILES notation for N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide?
The canonical SMILES for N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide is CN(N(C(=O)c1ccccc1)c1ccccn1)C(C)(C)C.
What is the InChIKey of N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide?
The InChIKey is CRNQIDHNTIHKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c1-17(2,3)19(4)20(15-12-8-9-13-18-15)16(21)14-10-6-5-7-11-14/h5-13H,1-4H3.
What are the key properties of N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide?
N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide has a molecular weight of 283.38 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-N'-methyl-N-pyridin-2-ylbenzohydrazide is sourced from PubChem (CID 19368177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).