C20H31N3O — CID 19370393
4-(dipropylamino)-N,N-dimethyl-1,2,2a,3,4,5-hexahydrobenzo[cd]indole-6-carboxamide (PubChem CID 19370393) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-(dipropylamino)-N,N-dimethyl-1,2,2a,3,4,5-hexahydrobenzo[cd]indole-6-carboxamide.
| Compound Name | 4-(dipropylamino)-N,N-dimethyl-1,2,2a,3,4,5-hexahydrobenzo[cd]indole-6-carboxamide |
|---|---|
| PubChem CID | 19370393 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 4-(dipropylamino)-N,N-dimethyl-1,2,2a,3,4,5-hexahydrobenzo[cd]indole-6-carboxamide |
| SMILES | CCCN(CCC)C1Cc2c(C(=O)N(C)C)ccc3c2C(CN3)C1 |
| InChI | InChI=1S/C20H31N3O/c1-5-9-23(10-6-2)15-11-14-13-21-18-8-7-16(20(24)22(3)4)17(12-15)19(14)18/h7-8,14-15,21H,5-6,9-13H2,1-4H3 |
| InChIKey | JALIAGVCLBDICD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |