C11H13ClFN3O — CID 19370468
(E)-N-[(2-fluorophenyl)methoxy]-4,6-dihydro-1H-pyrimidin-5-imine;hydrochloride (PubChem CID 19370468) has the molecular formula C11H13ClFN3O and a molecular weight of 257.70 g/mol. Its IUPAC name is (E)-N-[(2-fluorophenyl)methoxy]-4,6-dihydro-1H-pyrimidin-5-imine;hydrochloride.
| Compound Name | (E)-N-[(2-fluorophenyl)methoxy]-4,6-dihydro-1H-pyrimidin-5-imine;hydrochloride |
|---|---|
| PubChem CID | 19370468 |
| Molecular Formula | C11H13ClFN3O |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (E)-N-[(2-fluorophenyl)methoxy]-4,6-dihydro-1H-pyrimidin-5-imine;hydrochloride |
| SMILES | Cl.Fc1ccccc1CO/N=C1/CN=CNC1 |
| InChI | InChI=1S/C11H12FN3O.ClH/c12-11-4-2-1-3-9(11)7-16-15-10-5-13-8-14-6-10;/h1-4,8H,5-7H2,(H,13,14);1H |
| InChIKey | VQJGUMKQHUQATF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|