C11H12FN3O — CID 57217288
N-[(2-fluorophenyl)methoxy]-1,4-dihydropyrimidin-5-amine (PubChem CID 57217288) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methoxy]-1,4-dihydropyrimidin-5-amine.
| Compound Name | N-[(2-fluorophenyl)methoxy]-1,4-dihydropyrimidin-5-amine |
|---|---|
| PubChem CID | 57217288 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[(2-fluorophenyl)methoxy]-1,4-dihydropyrimidin-5-amine |
| SMILES | Fc1ccccc1CONC1=CNC=NC1 |
| InChI | InChI=1S/C11H12FN3O/c12-11-4-2-1-3-9(11)7-16-15-10-5-13-8-14-6-10/h1-5,8,15H,6-7H2,(H,13,14) |
| InChIKey | HTDDKDSJRNEQFX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|