C11H13N3O — CID 57185226
N-phenylmethoxy-1,4-dihydropyrimidin-5-amine (PubChem CID 57185226) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is N-phenylmethoxy-1,4-dihydropyrimidin-5-amine.
| Compound Name | N-phenylmethoxy-1,4-dihydropyrimidin-5-amine |
|---|---|
| PubChem CID | 57185226 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-phenylmethoxy-1,4-dihydropyrimidin-5-amine |
| SMILES | C1=NCC(NOCc2ccccc2)=CN1 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-10(5-3-1)8-15-14-11-6-12-9-13-7-11/h1-6,9,14H,7-8H2,(H,12,13) |
| InChIKey | JFHJJNDZTDOZIR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|