C12H16N2O — CID 57189109
N-phenylmethoxy-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 57189109) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-phenylmethoxy-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | N-phenylmethoxy-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 57189109 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-phenylmethoxy-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | C1=C(NOCc2ccccc2)CCNC1 |
| InChI | InChI=1S/C12H16N2O/c1-2-4-11(5-3-1)10-15-14-12-6-8-13-9-7-12/h1-6,13-14H,7-10H2 |
| InChIKey | CZBDXVNSASQPCS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|