C13H14FN3O — CID 91322881
2-fluoro-5-[(1,2,3,6-tetrahydropyridin-4-ylamino)oxymethyl]benzonitrile (PubChem CID 91322881) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-fluoro-5-[(1,2,3,6-tetrahydropyridin-4-ylamino)oxymethyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(1,2,3,6-tetrahydropyridin-4-ylamino)oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 91322881 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-fluoro-5-[(1,2,3,6-tetrahydropyridin-4-ylamino)oxymethyl]benzonitrile |
| SMILES | N#Cc1cc(CONC2=CCNCC2)ccc1F |
| InChI | InChI=1S/C13H14FN3O/c14-13-2-1-10(7-11(13)8-15)9-18-17-12-3-5-16-6-4-12/h1-3,7,16-17H,4-6,9H2 |
| InChIKey | MPQFMEICKONWAK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|