About 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile
2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile (PubChem CID 19371533) has the molecular formula C19H19FN4
and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile |
| PubChem CID | 19371533 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(=C2c3cc(F)ccc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C19H19FN4/c20-16-2-1-14-5-10-24-12-7-22-19(24)18(17(14)13-16)15-3-8-23(9-4-15)11-6-21/h1-2,7,12-13H,3-5,8-11H2 |
| InChIKey | XNZOBIKRWZNVFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile?
The IUPAC name of 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile (CID 19371533) is 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile?
The canonical SMILES for 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile is N#CCN1CCC(=C2c3cc(F)ccc3CCn3ccnc32)CC1.
What is the InChIKey of 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile?
The InChIKey is XNZOBIKRWZNVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN4/c20-16-2-1-14-5-10-24-12-7-22-19(24)18(17(14)13-16)15-3-8-23(9-4-15)11-6-21/h1-2,7,12-13H,3-5,8-11H2.
What are the key properties of 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile?
2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile has a molecular weight of 322.39 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile is sourced from PubChem (CID 19371533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).