C19H19FN4 — CID 19371533
2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile (PubChem CID 19371533) has the molecular formula C19H19FN4 and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 19371533 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[4-(9-fluoro-5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(=C2c3cc(F)ccc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C19H19FN4/c20-16-2-1-14-5-10-24-12-7-22-19(24)18(17(14)13-16)15-3-8-23(9-4-15)11-6-21/h1-2,7,12-13H,3-5,8-11H2 |
| InChIKey | XNZOBIKRWZNVFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|