C18H29NO5 — CID 19375116
4-(2,2-dimethoxyethyl)-2-nitro-1-octoxybenzene (PubChem CID 19375116) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethyl)-2-nitro-1-octoxybenzene.
| Compound Name | 4-(2,2-dimethoxyethyl)-2-nitro-1-octoxybenzene |
|---|---|
| PubChem CID | 19375116 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 4-(2,2-dimethoxyethyl)-2-nitro-1-octoxybenzene |
| SMILES | CCCCCCCCOc1ccc(CC(OC)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29NO5/c1-4-5-6-7-8-9-12-24-17-11-10-15(13-16(17)19(20)21)14-18(22-2)23-3/h10-11,13,18H,4-9,12,14H2,1-3H3 |
| InChIKey | RSLHWIQDCAHVDK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|