C19H29NO4 — CID 19377067
3-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentyl propaneperoxoate (PubChem CID 19377067) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 3-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentyl propaneperoxoate.
| Compound Name | 3-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentyl propaneperoxoate |
|---|---|
| PubChem CID | 19377067 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentyl propaneperoxoate |
| SMILES | CCC(=O)OOCCC(CC)NC1CCc2cccc(OC)c2C1 |
| InChI | InChI=1S/C19H29NO4/c1-4-15(11-12-23-24-19(21)5-2)20-16-10-9-14-7-6-8-18(22-3)17(14)13-16/h6-8,15-16,20H,4-5,9-13H2,1-3H3 |
| InChIKey | UCJGUEOPLAFVMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|