C19H27NO5S — CID 19378612
2-(cyclohexylmethyl)-4-[3-(dimethylsulfamoyl)phenyl]-4-oxobutanoic acid (PubChem CID 19378612) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4-[3-(dimethylsulfamoyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 2-(cyclohexylmethyl)-4-[3-(dimethylsulfamoyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19378612 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(cyclohexylmethyl)-4-[3-(dimethylsulfamoyl)phenyl]-4-oxobutanoic acid |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)CC(CC2CCCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C19H27NO5S/c1-20(2)26(24,25)17-10-6-9-15(12-17)18(21)13-16(19(22)23)11-14-7-4-3-5-8-14/h6,9-10,12,14,16H,3-5,7-8,11,13H2,1-2H3,(H,22,23) |
| InChIKey | FDBBIKBVXZVCPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |