About 4-ethyl-1H-pyridin-2-one
4-ethyl-1H-pyridin-2-one (PubChem CID 19378747) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 4-ethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-ethyl-1H-pyridin-2-one |
| PubChem CID | 19378747 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 4-ethyl-1H-pyridin-2-one |
| SMILES | CCc1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C7H9NO/c1-2-6-3-4-8-7(9)5-6/h3-5H,2H2,1H3,(H,8,9) |
| InChIKey | XNPOEWPFEMDQDF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1H-pyridin-2-one?
The IUPAC name of 4-ethyl-1H-pyridin-2-one (CID 19378747) is 4-ethyl-1H-pyridin-2-one.
What is the SMILES notation for 4-ethyl-1H-pyridin-2-one?
The canonical SMILES for 4-ethyl-1H-pyridin-2-one is CCc1cc[nH]c(=O)c1.
What is the InChIKey of 4-ethyl-1H-pyridin-2-one?
The InChIKey is XNPOEWPFEMDQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-2-6-3-4-8-7(9)5-6/h3-5H,2H2,1H3,(H,8,9).
What are the key properties of 4-ethyl-1H-pyridin-2-one?
4-ethyl-1H-pyridin-2-one has a molecular weight of 123.15 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1H-pyridin-2-one is sourced from PubChem (CID 19378747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).