C23H25ClN2O5 — CID 19378809
1-[6-(2-chloro-4-methoxyphenoxy)hexyl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 19378809) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is 1-[6-(2-chloro-4-methoxyphenoxy)hexyl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-[6-(2-chloro-4-methoxyphenoxy)hexyl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19378809 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-[6-(2-chloro-4-methoxyphenoxy)hexyl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | COc1ccc(OCCCCCCn2cc(C(=O)O)c(=O)c3ccc(C)nc32)c(Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O5/c1-15-7-9-17-21(27)18(23(28)29)14-26(22(17)25-15)11-5-3-4-6-12-31-20-10-8-16(30-2)13-19(20)24/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,28,29) |
| InChIKey | ZAVMEVPOGKAQRU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|