About methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate
methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate (PubChem CID 19379366) has the molecular formula C24H25F6NO3
and a molecular weight of 489.46 g/mol. Its IUPAC name is methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate |
| PubChem CID | 19379366 |
| Molecular Formula | C24H25F6NO3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate |
| SMILES | COC(=O)C(C)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C24H25F6NO3/c1-15(22(32)33-2)31-10-6-9-20(21(31)17-7-4-3-5-8-17)34-14-16-11-18(23(25,26)27)13-19(12-16)24(28,29)30/h3-5,7-8,11-13,15,20-21H,6,9-10,14H2,1-2H3 |
| InChIKey | WZSJKVLDDBIGJX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate?
The IUPAC name of methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate (CID 19379366) is methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate.
What is the SMILES notation for methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate?
The canonical SMILES for methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate is COC(=O)C(C)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1.
What is the InChIKey of methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate?
The InChIKey is WZSJKVLDDBIGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F6NO3/c1-15(22(32)33-2)31-10-6-9-20(21(31)17-7-4-3-5-8-17)34-14-16-11-18(23(25,26)27)13-19(12-16)24(28,29)30/h3-5,7-8,11-13,15,20-21H,6,9-10,14H2,1-2H3.
What are the key properties of methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate?
methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate has a molecular weight of 489.46 g/mol, XLogP of 6.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]propanoate is sourced from PubChem (CID 19379366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).