C15H4KN7+2 — CID 19379557
potassium 1-pyridin-4-ylpyridin-1-ium-2,3,4,5,6-pentacarbonitrile (PubChem CID 19379557) has the molecular formula C15H4KN7+2 and a molecular weight of 321.34 g/mol. Its IUPAC name is potassium 1-pyridin-4-ylpyridin-1-ium-2,3,4,5,6-pentacarbonitrile.
| Compound Name | potassium 1-pyridin-4-ylpyridin-1-ium-2,3,4,5,6-pentacarbonitrile |
|---|---|
| PubChem CID | 19379557 |
| Molecular Formula | C15H4KN7+2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | potassium 1-pyridin-4-ylpyridin-1-ium-2,3,4,5,6-pentacarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)[n+](-c2ccncc2)c(C#N)c1C#N.[K+] |
| InChI | InChI=1S/C15H4N7.K/c16-5-11-12(6-17)14(8-19)22(10-1-3-21-4-2-10)15(9-20)13(11)7-18;/h1-4H;/q2*+1 |
| InChIKey | VMPGTTBBGZXLRW-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|