C16H4N6 — CID 158035055
6-pyridin-4-ylbenzene-1,2,3,4,5-pentacarbonitrile (PubChem CID 158035055) has the molecular formula C16H4N6 and a molecular weight of 280.25 g/mol. Its IUPAC name is 6-pyridin-4-ylbenzene-1,2,3,4,5-pentacarbonitrile.
| Compound Name | 6-pyridin-4-ylbenzene-1,2,3,4,5-pentacarbonitrile |
|---|---|
| PubChem CID | 158035055 |
| Molecular Formula | C16H4N6 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 6-pyridin-4-ylbenzene-1,2,3,4,5-pentacarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c(-c2ccncc2)c(C#N)c1C#N |
| InChI | InChI=1S/C16H4N6/c17-5-11-12(6-18)14(8-20)16(10-1-3-22-4-2-10)15(9-21)13(11)7-19/h1-4H |
| InChIKey | FHQKEZLCHNZVOF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 131.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |