C16H24BrN — CID 19379897
1-bromo-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 19379897) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is 1-bromo-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-bromo-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 19379897 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-bromo-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2ccccc2C1Br |
| InChI | InChI=1S/C16H24BrN/c1-3-11-18(12-4-2)15-10-9-13-7-5-6-8-14(13)16(15)17/h5-8,15-16H,3-4,9-12H2,1-2H3 |
| InChIKey | SVBNMKBCLVUJAF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|