C18H19NO2 — CID 19379905
3-[3-hydroxy-2-(3-phenylpropyl)phenoxy]propanenitrile (PubChem CID 19379905) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[3-hydroxy-2-(3-phenylpropyl)phenoxy]propanenitrile.
| Compound Name | 3-[3-hydroxy-2-(3-phenylpropyl)phenoxy]propanenitrile |
|---|---|
| PubChem CID | 19379905 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[3-hydroxy-2-(3-phenylpropyl)phenoxy]propanenitrile |
| SMILES | N#CCCOc1cccc(O)c1CCCc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c19-13-6-14-21-18-12-5-11-17(20)16(18)10-4-9-15-7-2-1-3-8-15/h1-3,5,7-8,11-12,20H,4,6,9-10,14H2 |
| InChIKey | PUYZCKINUMURQR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|