C19H20ClFO2S — CID 19379941
4-[3-[4-(chloromethyl)phenyl]sulfanyl-5-fluorophenyl]-4-methoxyoxane (PubChem CID 19379941) has the molecular formula C19H20ClFO2S and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-[3-[4-(chloromethyl)phenyl]sulfanyl-5-fluorophenyl]-4-methoxyoxane.
| Compound Name | 4-[3-[4-(chloromethyl)phenyl]sulfanyl-5-fluorophenyl]-4-methoxyoxane |
|---|---|
| PubChem CID | 19379941 |
| Molecular Formula | C19H20ClFO2S |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-[3-[4-(chloromethyl)phenyl]sulfanyl-5-fluorophenyl]-4-methoxyoxane |
| SMILES | COC1(c2cc(F)cc(Sc3ccc(CCl)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C19H20ClFO2S/c1-22-19(6-8-23-9-7-19)15-10-16(21)12-18(11-15)24-17-4-2-14(13-20)3-5-17/h2-5,10-12H,6-9,13H2,1H3 |
| InChIKey | NUBFBRXXACSKON-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|