C26H27FO2S — CID 19106767
4-[3-[4-[1-(4-fluorophenyl)ethyl]phenyl]sulfanylphenyl]-4-methoxyoxane (PubChem CID 19106767) has the molecular formula C26H27FO2S and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[3-[4-[1-(4-fluorophenyl)ethyl]phenyl]sulfanylphenyl]-4-methoxyoxane.
| Compound Name | 4-[3-[4-[1-(4-fluorophenyl)ethyl]phenyl]sulfanylphenyl]-4-methoxyoxane |
|---|---|
| PubChem CID | 19106767 |
| Molecular Formula | C26H27FO2S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-[3-[4-[1-(4-fluorophenyl)ethyl]phenyl]sulfanylphenyl]-4-methoxyoxane |
| SMILES | COC1(c2cccc(Sc3ccc(C(C)c4ccc(F)cc4)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C26H27FO2S/c1-19(20-6-10-23(27)11-7-20)21-8-12-24(13-9-21)30-25-5-3-4-22(18-25)26(28-2)14-16-29-17-15-26/h3-13,18-19H,14-17H2,1-2H3 |
| InChIKey | BRKDNQXUDGPJDQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |