C29H40N2O2 — CID 19381449
(E)-N-ethyl-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-4-phenylbut-3-enamide (PubChem CID 19381449) has the molecular formula C29H40N2O2 and a molecular weight of 448.65 g/mol. Its IUPAC name is (E)-N-ethyl-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-4-phenylbut-3-enamide.
| Compound Name | (E)-N-ethyl-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 19381449 |
| Molecular Formula | C29H40N2O2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | (E)-N-ethyl-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-4-phenylbut-3-enamide |
| SMILES | CCN(C(=O)C/C=C/c1ccccc1)C1CCC(c2ccc(CNCCCCO)cc2)CC1 |
| InChI | InChI=1S/C29H40N2O2/c1-2-31(29(33)12-8-11-24-9-4-3-5-10-24)28-19-17-27(18-20-28)26-15-13-25(14-16-26)23-30-21-6-7-22-32/h3-5,8-11,13-16,27-28,30,32H,2,6-7,12,17-23H2,1H3/b11-8+ |
| InChIKey | HBRRGWCRRMEUIS-DHZHZOJOSA-N |
| XLogP | 5.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|