C20H22N2O3 — CID 19384381
1-amino-4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol (PubChem CID 19384381) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-amino-4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol.
| Compound Name | 1-amino-4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 19384381 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-amino-4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol |
| SMILES | NC1(O)CCC(OCc2ccc(-c3nc4ccccc4o3)cc2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c21-20(23)11-9-16(10-12-20)24-13-14-5-7-15(8-6-14)19-22-17-3-1-2-4-18(17)25-19/h1-8,16,23H,9-13,21H2 |
| InChIKey | BRGGLDDETCDESU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|