C10H12N2O2 — CID 19385019
N-[5-(oxiran-2-ylmethyl)-2-pyridinyl]acetamide (PubChem CID 19385019) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[5-(oxiran-2-ylmethyl)-2-pyridinyl]acetamide.
| Compound Name | N-[5-(oxiran-2-ylmethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 19385019 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[5-(oxiran-2-ylmethyl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC2CO2)cn1 |
| InChI | InChI=1S/C10H12N2O2/c1-7(13)12-10-3-2-8(5-11-10)4-9-6-14-9/h2-3,5,9H,4,6H2,1H3,(H,11,12,13) |
| InChIKey | YYXLWCYQXRRSQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|