C16H13BrCl2O3 — CID 19385677
methyl 2-[4-(bromomethyl)-2,6-dichlorophenoxy]-2-phenylacetate (PubChem CID 19385677) has the molecular formula C16H13BrCl2O3 and a molecular weight of 404.09 g/mol. Its IUPAC name is methyl 2-[4-(bromomethyl)-2,6-dichlorophenoxy]-2-phenylacetate.
| Compound Name | methyl 2-[4-(bromomethyl)-2,6-dichlorophenoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 19385677 |
| Molecular Formula | C16H13BrCl2O3 |
| Molecular Weight | 404.09 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | methyl 2-[4-(bromomethyl)-2,6-dichlorophenoxy]-2-phenylacetate |
| SMILES | COC(=O)C(Oc1c(Cl)cc(CBr)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13BrCl2O3/c1-21-16(20)14(11-5-3-2-4-6-11)22-15-12(18)7-10(9-17)8-13(15)19/h2-8,14H,9H2,1H3 |
| InChIKey | NFCYUZMMMSWURE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.09 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|