C26H39NO8 — CID 19389022
2-[N-(carboxymethyl)-3,5-di(octanoyloxy)anilino]acetic acid (PubChem CID 19389022) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-3,5-di(octanoyloxy)anilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-3,5-di(octanoyloxy)anilino]acetic acid |
|---|---|
| PubChem CID | 19389022 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 2-[N-(carboxymethyl)-3,5-di(octanoyloxy)anilino]acetic acid |
| SMILES | CCCCCCCC(=O)Oc1cc(OC(=O)CCCCCCC)cc(N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C26H39NO8/c1-3-5-7-9-11-13-25(32)34-21-15-20(27(18-23(28)29)19-24(30)31)16-22(17-21)35-26(33)14-12-10-8-6-4-2/h15-17H,3-14,18-19H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | JCHBCDMXUKRVNS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|