C22H34N6O3 — CID 19391592
2-methylpropyl 4-[[4-(5-carbamimidoyl-2-pyridinyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 19391592) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-methylpropyl 4-[[4-(5-carbamimidoyl-2-pyridinyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[[4-(5-carbamimidoyl-2-pyridinyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19391592 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-methylpropyl 4-[[4-(5-carbamimidoyl-2-pyridinyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C(=O)NC3CCC(C(=O)OCC(C)C)CC3)CC2)nc1 |
| InChI | InChI=1S/C22H34N6O3/c1-15(2)14-31-21(29)16-3-6-18(7-4-16)26-22(30)28-11-9-27(10-12-28)19-8-5-17(13-25-19)20(23)24/h5,8,13,15-16,18H,3-4,6-7,9-12,14H2,1-2H3,(H3,23,24)(H,26,30) |
| InChIKey | BGPXORAZNXUSNC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|