C18H23Cl2N5 — CID 19392165
4-cyclohexyl-2-imidazol-1-yl-N-methylquinazolin-5-amine;dihydrochloride (PubChem CID 19392165) has the molecular formula C18H23Cl2N5 and a molecular weight of 380.32 g/mol. Its IUPAC name is 4-cyclohexyl-2-imidazol-1-yl-N-methylquinazolin-5-amine;dihydrochloride.
| Compound Name | 4-cyclohexyl-2-imidazol-1-yl-N-methylquinazolin-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 19392165 |
| Molecular Formula | C18H23Cl2N5 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-cyclohexyl-2-imidazol-1-yl-N-methylquinazolin-5-amine;dihydrochloride |
| SMILES | CNc1cccc2nc(-n3ccnc3)nc(C3CCCCC3)c12.Cl.Cl |
| InChI | InChI=1S/C18H21N5.2ClH/c1-19-14-8-5-9-15-16(14)17(13-6-3-2-4-7-13)22-18(21-15)23-11-10-20-12-23;;/h5,8-13,19H,2-4,6-7H2,1H3;2*1H |
| InChIKey | ZVOYMOMJHKIYNT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |