C18H17F3N4O2 — CID 19392287
2-[2-[[2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-yl]amino]ethoxy]ethanol (PubChem CID 19392287) has the molecular formula C18H17F3N4O2 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2-[2-[[2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 19392287 |
| Molecular Formula | C18H17F3N4O2 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[2-[[2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-yl]amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc(-c2ccc(C(F)(F)F)nc2)nc2ccccc12 |
| InChI | InChI=1S/C18H17F3N4O2/c19-18(20,21)15-6-5-12(11-23-15)16-24-14-4-2-1-3-13(14)17(25-16)22-7-9-27-10-8-26/h1-6,11,26H,7-10H2,(H,22,24,25) |
| InChIKey | OJAHRJRTUWMTCS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|