C25H21BrClN3O2 — CID 19394542
N-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenoxy)methyl]benzamide (PubChem CID 19394542) has the molecular formula C25H21BrClN3O2 and a molecular weight of 510.82 g/mol. Its IUPAC name is N-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenoxy)methyl]benzamide.
| Compound Name | N-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19394542 |
| Molecular Formula | C25H21BrClN3O2 |
| Molecular Weight | 510.82 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | N-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenoxy)methyl]benzamide |
| SMILES | Cc1ccc(Cn2cc(Br)c(NC(=O)c3cccc(COc4ccc(Cl)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C25H21BrClN3O2/c1-17-5-7-18(8-6-17)14-30-15-23(26)24(29-30)28-25(31)20-4-2-3-19(13-20)16-32-22-11-9-21(27)10-12-22/h2-13,15H,14,16H2,1H3,(H,28,29,31) |
| InChIKey | JXKYNKHZKAAECB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.82 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |